C16H18N2O5S — CID 119238107
(2S)-2-[3-(naphthalen-2-ylsulfonylamino)propanoylamino]propanoic acid (PubChem CID 119238107) has the molecular formula C16H18N2O5S and a molecular weight of 350.40 g/mol. Its IUPAC name is (2S)-2-[3-(naphthalen-2-ylsulfonylamino)propanoylamino]propanoic acid.
| Compound Name | (2S)-2-[3-(naphthalen-2-ylsulfonylamino)propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 119238107 |
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | (2S)-2-[3-(naphthalen-2-ylsulfonylamino)propanoylamino]propanoic acid |
| SMILES | C[C@H](NC(=O)CCNS(=O)(=O)c1ccc2ccccc2c1)C(=O)O |
| InChI | InChI=1S/C16H18N2O5S/c1-11(16(20)21)18-15(19)8-9-17-24(22,23)14-7-6-12-4-2-3-5-13(12)10-14/h2-7,10-11,17H,8-9H2,1H3,(H,18,19)(H,20,21)/t11-/m0/s1 |
| InChIKey | HZRBDLKHXFZDPT-NSHDSACASA-N |
| XLogP | 1.10 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |