C11H15N3O5S — CID 119943288
(2S)-2-[3-(pyridin-3-ylsulfonylamino)propanoylamino]propanoic acid (PubChem CID 119943288) has the molecular formula C11H15N3O5S and a molecular weight of 301.32 g/mol. Its IUPAC name is (2S)-2-[3-(pyridin-3-ylsulfonylamino)propanoylamino]propanoic acid.
| Compound Name | (2S)-2-[3-(pyridin-3-ylsulfonylamino)propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 119943288 |
| Molecular Formula | C11H15N3O5S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | (2S)-2-[3-(pyridin-3-ylsulfonylamino)propanoylamino]propanoic acid |
| SMILES | C[C@H](NC(=O)CCNS(=O)(=O)c1cccnc1)C(=O)O |
| InChI | InChI=1S/C11H15N3O5S/c1-8(11(16)17)14-10(15)4-6-13-20(18,19)9-3-2-5-12-7-9/h2-3,5,7-8,13H,4,6H2,1H3,(H,14,15)(H,16,17)/t8-/m0/s1 |
| InChIKey | GNIIOUXDBIQZOT-QMMMGPOBSA-N |
| XLogP | -0.66 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |