C14H21N3O5S — CID 119357149
4-methyl-4-[3-(pyridin-3-ylsulfonylamino)propanoylamino]pentanoic acid (PubChem CID 119357149) has the molecular formula C14H21N3O5S and a molecular weight of 343.41 g/mol. Its IUPAC name is 4-methyl-4-[3-(pyridin-3-ylsulfonylamino)propanoylamino]pentanoic acid.
| Compound Name | 4-methyl-4-[3-(pyridin-3-ylsulfonylamino)propanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 119357149 |
| Molecular Formula | C14H21N3O5S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 4-methyl-4-[3-(pyridin-3-ylsulfonylamino)propanoylamino]pentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)CCNS(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C14H21N3O5S/c1-14(2,7-5-13(19)20)17-12(18)6-9-16-23(21,22)11-4-3-8-15-10-11/h3-4,8,10,16H,5-7,9H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | ICKPSZIPGKSDHN-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |