C9H15N3O2S — CID 115303456
N-(2-amino-2-methylpropyl)pyridine-3-sulfonamide (PubChem CID 115303456) has the molecular formula C9H15N3O2S and a molecular weight of 229.31 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)pyridine-3-sulfonamide.
| Compound Name | N-(2-amino-2-methylpropyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 115303456 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | N-(2-amino-2-methylpropyl)pyridine-3-sulfonamide |
| SMILES | CC(C)(N)CNS(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C9H15N3O2S/c1-9(2,10)7-12-15(13,14)8-4-3-5-11-6-8/h3-6,12H,7,10H2,1-2H3 |
| InChIKey | KPKPNCHLXOGZJQ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |