C14H24N4O3S — CID 119642641
N-(2-amino-2-ethylbutyl)-3-(pyridin-3-ylsulfonylamino)propanamide (PubChem CID 119642641) has the molecular formula C14H24N4O3S and a molecular weight of 328.44 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-3-(pyridin-3-ylsulfonylamino)propanamide.
| Compound Name | N-(2-amino-2-ethylbutyl)-3-(pyridin-3-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 119642641 |
| Molecular Formula | C14H24N4O3S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-3-(pyridin-3-ylsulfonylamino)propanamide |
| SMILES | CCC(N)(CC)CNC(=O)CCNS(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C14H24N4O3S/c1-3-14(15,4-2)11-17-13(19)7-9-18-22(20,21)12-6-5-8-16-10-12/h5-6,8,10,18H,3-4,7,9,11,15H2,1-2H3,(H,17,19) |
| InChIKey | UFMHZQVSRLFEJQ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |