C16H18ClN3O3S2 — CID 43072425
N-[2-(4-chlorophenyl)sulfanylethyl]-3-(pyridin-3-ylsulfonylamino)propanamide (PubChem CID 43072425) has the molecular formula C16H18ClN3O3S2 and a molecular weight of 399.93 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylethyl]-3-(pyridin-3-ylsulfonylamino)propanamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylethyl]-3-(pyridin-3-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 43072425 |
| Molecular Formula | C16H18ClN3O3S2 |
| Molecular Weight | 399.93 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylethyl]-3-(pyridin-3-ylsulfonylamino)propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1cccnc1)NCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H18ClN3O3S2/c17-13-3-5-14(6-4-13)24-11-10-19-16(21)7-9-20-25(22,23)15-2-1-8-18-12-15/h1-6,8,12,20H,7,9-11H2,(H,19,21) |
| InChIKey | FZJRDYCZPJOKPK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.93 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|