C16H20ClN3O4S2 — CID 9259359
N-[2-(4-chlorophenyl)sulfanylethyl]-3-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]propanamide (PubChem CID 9259359) has the molecular formula C16H20ClN3O4S2 and a molecular weight of 417.94 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylethyl]-3-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]propanamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylethyl]-3-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 9259359 |
| Molecular Formula | C16H20ClN3O4S2 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylethyl]-3-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]propanamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)NCCC(=O)NCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H20ClN3O4S2/c1-11-16(12(2)24-20-11)26(22,23)19-8-7-15(21)18-9-10-25-14-5-3-13(17)4-6-14/h3-6,19H,7-10H2,1-2H3,(H,18,21) |
| InChIKey | YHDYOSWXDDTTMT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|