C16H17ClN2O4S — CID 8954492
[2-[2-(4-chlorophenyl)sulfanylethylamino]-2-oxoethyl] 3,5-dimethyl-1,2-oxazole-4-carboxylate (PubChem CID 8954492) has the molecular formula C16H17ClN2O4S and a molecular weight of 368.84 g/mol. Its IUPAC name is [2-[2-(4-chlorophenyl)sulfanylethylamino]-2-oxoethyl] 3,5-dimethyl-1,2-oxazole-4-carboxylate.
| Compound Name | [2-[2-(4-chlorophenyl)sulfanylethylamino]-2-oxoethyl] 3,5-dimethyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 8954492 |
| Molecular Formula | C16H17ClN2O4S |
| Molecular Weight | 368.84 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | [2-[2-(4-chlorophenyl)sulfanylethylamino]-2-oxoethyl] 3,5-dimethyl-1,2-oxazole-4-carboxylate |
| SMILES | Cc1noc(C)c1C(=O)OCC(=O)NCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H17ClN2O4S/c1-10-15(11(2)23-19-10)16(21)22-9-14(20)18-7-8-24-13-5-3-12(17)4-6-13/h3-6H,7-9H2,1-2H3,(H,18,20) |
| InChIKey | NFGQNIAIOQASQD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.84 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|