C19H20ClNO5S — CID 8872357
[2-[2-(4-chlorophenyl)sulfanylethylamino]-2-oxoethyl] 2,6-dimethoxybenzoate (PubChem CID 8872357) has the molecular formula C19H20ClNO5S and a molecular weight of 409.89 g/mol. Its IUPAC name is [2-[2-(4-chlorophenyl)sulfanylethylamino]-2-oxoethyl] 2,6-dimethoxybenzoate.
| Compound Name | [2-[2-(4-chlorophenyl)sulfanylethylamino]-2-oxoethyl] 2,6-dimethoxybenzoate |
|---|---|
| PubChem CID | 8872357 |
| Molecular Formula | C19H20ClNO5S |
| Molecular Weight | 409.89 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | [2-[2-(4-chlorophenyl)sulfanylethylamino]-2-oxoethyl] 2,6-dimethoxybenzoate |
| SMILES | COc1cccc(OC)c1C(=O)OCC(=O)NCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H20ClNO5S/c1-24-15-4-3-5-16(25-2)18(15)19(23)26-12-17(22)21-10-11-27-14-8-6-13(20)7-9-14/h3-9H,10-12H2,1-2H3,(H,21,22) |
| InChIKey | NUGRISGPMSLRKF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.89 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|