C24H28N2O10 — CID 24683584
[2-[2-[[2-(2,6-dimethoxybenzoyl)oxyacetyl]amino]ethylamino]-2-oxoethyl] 2,6-dimethoxybenzoate (PubChem CID 24683584) has the molecular formula C24H28N2O10 and a molecular weight of 504.49 g/mol. Its IUPAC name is [2-[2-[[2-(2,6-dimethoxybenzoyl)oxyacetyl]amino]ethylamino]-2-oxoethyl] 2,6-dimethoxybenzoate.
| Compound Name | [2-[2-[[2-(2,6-dimethoxybenzoyl)oxyacetyl]amino]ethylamino]-2-oxoethyl] 2,6-dimethoxybenzoate |
|---|---|
| PubChem CID | 24683584 |
| Molecular Formula | C24H28N2O10 |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | [2-[2-[[2-(2,6-dimethoxybenzoyl)oxyacetyl]amino]ethylamino]-2-oxoethyl] 2,6-dimethoxybenzoate |
| SMILES | COc1cccc(OC)c1C(=O)OCC(=O)NCCNC(=O)COC(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C24H28N2O10/c1-31-15-7-5-8-16(32-2)21(15)23(29)35-13-19(27)25-11-12-26-20(28)14-36-24(30)22-17(33-3)9-6-10-18(22)34-4/h5-10H,11-14H2,1-4H3,(H,25,27)(H,26,28) |
| InChIKey | DSBRKKYZKMHWDN-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 147.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|