C17H16INO5 — CID 2636059
[2-(2-iodoanilino)-2-oxoethyl] 2,6-dimethoxybenzoate (PubChem CID 2636059) has the molecular formula C17H16INO5 and a molecular weight of 441.22 g/mol. Its IUPAC name is [2-(2-iodoanilino)-2-oxoethyl] 2,6-dimethoxybenzoate.
| Compound Name | [2-(2-iodoanilino)-2-oxoethyl] 2,6-dimethoxybenzoate |
|---|---|
| PubChem CID | 2636059 |
| Molecular Formula | C17H16INO5 |
| Molecular Weight | 441.22 g/mol |
| Exact Mass | 441.01 |
| IUPAC Name | [2-(2-iodoanilino)-2-oxoethyl] 2,6-dimethoxybenzoate |
| SMILES | COc1cccc(OC)c1C(=O)OCC(=O)Nc1ccccc1I |
| InChI | InChI=1S/C17H16INO5/c1-22-13-8-5-9-14(23-2)16(13)17(21)24-10-15(20)19-12-7-4-3-6-11(12)18/h3-9H,10H2,1-2H3,(H,19,20) |
| InChIKey | NRDPSWHUDVBXQX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.22 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|