C13H12IN3O4 — CID 46639271
[2-(2-iodoanilino)-2-oxoethyl] 5-amino-3-methyl-1,2-oxazole-4-carboxylate (PubChem CID 46639271) has the molecular formula C13H12IN3O4 and a molecular weight of 401.16 g/mol. Its IUPAC name is [2-(2-iodoanilino)-2-oxoethyl] 5-amino-3-methyl-1,2-oxazole-4-carboxylate.
| Compound Name | [2-(2-iodoanilino)-2-oxoethyl] 5-amino-3-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 46639271 |
| Molecular Formula | C13H12IN3O4 |
| Molecular Weight | 401.16 g/mol |
| Exact Mass | 400.99 |
| IUPAC Name | [2-(2-iodoanilino)-2-oxoethyl] 5-amino-3-methyl-1,2-oxazole-4-carboxylate |
| SMILES | Cc1noc(N)c1C(=O)OCC(=O)Nc1ccccc1I |
| InChI | InChI=1S/C13H12IN3O4/c1-7-11(12(15)21-17-7)13(19)20-6-10(18)16-9-5-3-2-4-8(9)14/h2-5H,6,15H2,1H3,(H,16,18) |
| InChIKey | NJNDQSXHTPZEOK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.16 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|