C12H10IN3O3 — CID 55646238
[2-(2-iodoanilino)-2-oxoethyl] 1H-pyrazole-5-carboxylate (PubChem CID 55646238) has the molecular formula C12H10IN3O3 and a molecular weight of 371.13 g/mol. Its IUPAC name is [2-(2-iodoanilino)-2-oxoethyl] 1H-pyrazole-5-carboxylate.
| Compound Name | [2-(2-iodoanilino)-2-oxoethyl] 1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 55646238 |
| Molecular Formula | C12H10IN3O3 |
| Molecular Weight | 371.13 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | [2-(2-iodoanilino)-2-oxoethyl] 1H-pyrazole-5-carboxylate |
| SMILES | O=C(COC(=O)c1ccn[nH]1)Nc1ccccc1I |
| InChI | InChI=1S/C12H10IN3O3/c13-8-3-1-2-4-9(8)15-11(17)7-19-12(18)10-5-6-14-16-10/h1-6H,7H2,(H,14,16)(H,15,17) |
| InChIKey | PECHUELCKRDQAV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.13 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|