C8H10N4O4 — CID 46428902
[2-(methylcarbamoylamino)-2-oxoethyl] 1H-pyrazole-5-carboxylate (PubChem CID 46428902) has the molecular formula C8H10N4O4 and a molecular weight of 226.19 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxoethyl] 1H-pyrazole-5-carboxylate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxoethyl] 1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 46428902 |
| Molecular Formula | C8H10N4O4 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxoethyl] 1H-pyrazole-5-carboxylate |
| SMILES | CNC(=O)NC(=O)COC(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C8H10N4O4/c1-9-8(15)11-6(13)4-16-7(14)5-2-3-10-12-5/h2-3H,4H2,1H3,(H,10,12)(H2,9,11,13,15) |
| InChIKey | WSDDZAXLINJKSX-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |