C11H11IN2O4 — CID 2509553
[2-(methylcarbamoylamino)-2-oxoethyl] 2-iodobenzoate (PubChem CID 2509553) has the molecular formula C11H11IN2O4 and a molecular weight of 362.12 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxoethyl] 2-iodobenzoate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxoethyl] 2-iodobenzoate |
|---|---|
| PubChem CID | 2509553 |
| Molecular Formula | C11H11IN2O4 |
| Molecular Weight | 362.12 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxoethyl] 2-iodobenzoate |
| SMILES | CNC(=O)NC(=O)COC(=O)c1ccccc1I |
| InChI | InChI=1S/C11H11IN2O4/c1-13-11(17)14-9(15)6-18-10(16)7-4-2-3-5-8(7)12/h2-5H,6H2,1H3,(H2,13,14,15,17) |
| InChIKey | AHIRFGLKPBBWRD-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.12 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|