C18H17IN2O4 — CID 2509396
[2-[(2,4-dimethylphenyl)carbamoylamino]-2-oxoethyl] 2-iodobenzoate (PubChem CID 2509396) has the molecular formula C18H17IN2O4 and a molecular weight of 452.25 g/mol. Its IUPAC name is [2-[(2,4-dimethylphenyl)carbamoylamino]-2-oxoethyl] 2-iodobenzoate.
| Compound Name | [2-[(2,4-dimethylphenyl)carbamoylamino]-2-oxoethyl] 2-iodobenzoate |
|---|---|
| PubChem CID | 2509396 |
| Molecular Formula | C18H17IN2O4 |
| Molecular Weight | 452.25 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | [2-[(2,4-dimethylphenyl)carbamoylamino]-2-oxoethyl] 2-iodobenzoate |
| SMILES | Cc1ccc(NC(=O)NC(=O)COC(=O)c2ccccc2I)c(C)c1 |
| InChI | InChI=1S/C18H17IN2O4/c1-11-7-8-15(12(2)9-11)20-18(24)21-16(22)10-25-17(23)13-5-3-4-6-14(13)19/h3-9H,10H2,1-2H3,(H2,20,21,22,24) |
| InChIKey | DYGZGGJMFALDPL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|