C19H20N2O4 — CID 112781528
2-(2-acetylphenoxy)-N-[(2,4-dimethylphenyl)carbamoyl]acetamide (PubChem CID 112781528) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-(2-acetylphenoxy)-N-[(2,4-dimethylphenyl)carbamoyl]acetamide.
| Compound Name | 2-(2-acetylphenoxy)-N-[(2,4-dimethylphenyl)carbamoyl]acetamide |
|---|---|
| PubChem CID | 112781528 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 2-(2-acetylphenoxy)-N-[(2,4-dimethylphenyl)carbamoyl]acetamide |
| SMILES | CC(=O)c1ccccc1OCC(=O)NC(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C19H20N2O4/c1-12-8-9-16(13(2)10-12)20-19(24)21-18(23)11-25-17-7-5-4-6-15(17)14(3)22/h4-10H,11H2,1-3H3,(H2,20,21,23,24) |
| InChIKey | MBWPXLQZCDXNLS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |