C17H16Br2N2O3 — CID 2632532
2-(2,4-dibromophenoxy)-N-[(2,4-dimethylphenyl)carbamoyl]acetamide (PubChem CID 2632532) has the molecular formula C17H16Br2N2O3 and a molecular weight of 456.13 g/mol. Its IUPAC name is 2-(2,4-dibromophenoxy)-N-[(2,4-dimethylphenyl)carbamoyl]acetamide.
| Compound Name | 2-(2,4-dibromophenoxy)-N-[(2,4-dimethylphenyl)carbamoyl]acetamide |
|---|---|
| PubChem CID | 2632532 |
| Molecular Formula | C17H16Br2N2O3 |
| Molecular Weight | 456.13 g/mol |
| Exact Mass | 453.95 |
| IUPAC Name | 2-(2,4-dibromophenoxy)-N-[(2,4-dimethylphenyl)carbamoyl]acetamide |
| SMILES | Cc1ccc(NC(=O)NC(=O)COc2ccc(Br)cc2Br)c(C)c1 |
| InChI | InChI=1S/C17H16Br2N2O3/c1-10-3-5-14(11(2)7-10)20-17(23)21-16(22)9-24-15-6-4-12(18)8-13(15)19/h3-8H,9H2,1-2H3,(H2,20,21,22,23) |
| InChIKey | BAWCGTQHOBIAOX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.13 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |