C16H14Br2N2O3S — CID 3313302
2-(2,4-dibromophenoxy)-N-[(2-hydroxy-5-methylphenyl)carbamothioyl]acetamide (PubChem CID 3313302) has the molecular formula C16H14Br2N2O3S and a molecular weight of 474.17 g/mol. Its IUPAC name is 2-(2,4-dibromophenoxy)-N-[(2-hydroxy-5-methylphenyl)carbamothioyl]acetamide.
| Compound Name | 2-(2,4-dibromophenoxy)-N-[(2-hydroxy-5-methylphenyl)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 3313302 |
| Molecular Formula | C16H14Br2N2O3S |
| Molecular Weight | 474.17 g/mol |
| Exact Mass | 471.91 |
| IUPAC Name | 2-(2,4-dibromophenoxy)-N-[(2-hydroxy-5-methylphenyl)carbamothioyl]acetamide |
| SMILES | Cc1ccc(O)c(NC(=S)NC(=O)COc2ccc(Br)cc2Br)c1 |
| InChI | InChI=1S/C16H14Br2N2O3S/c1-9-2-4-13(21)12(6-9)19-16(24)20-15(22)8-23-14-5-3-10(17)7-11(14)18/h2-7,21H,8H2,1H3,(H2,19,20,22,24) |
| InChIKey | GGRGYJURZVNQDM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.17 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|