C17H16Br2N2O2S — CID 3313169
2-(2,4-dibromophenoxy)-N-[(3,5-dimethylphenyl)carbamothioyl]acetamide (PubChem CID 3313169) has the molecular formula C17H16Br2N2O2S and a molecular weight of 472.20 g/mol. Its IUPAC name is 2-(2,4-dibromophenoxy)-N-[(3,5-dimethylphenyl)carbamothioyl]acetamide.
| Compound Name | 2-(2,4-dibromophenoxy)-N-[(3,5-dimethylphenyl)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 3313169 |
| Molecular Formula | C17H16Br2N2O2S |
| Molecular Weight | 472.20 g/mol |
| Exact Mass | 469.93 |
| IUPAC Name | 2-(2,4-dibromophenoxy)-N-[(3,5-dimethylphenyl)carbamothioyl]acetamide |
| SMILES | Cc1cc(C)cc(NC(=S)NC(=O)COc2ccc(Br)cc2Br)c1 |
| InChI | InChI=1S/C17H16Br2N2O2S/c1-10-5-11(2)7-13(6-10)20-17(24)21-16(22)9-23-15-4-3-12(18)8-14(15)19/h3-8H,9H2,1-2H3,(H2,20,21,22,24) |
| InChIKey | XVYLIRCTECDKJI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.20 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|