C20H21Br2N3O4S2 — CID 3316791
2-(2,4-dibromophenoxy)-N-[(4-piperidin-1-ylsulfonylphenyl)carbamothioyl]acetamide (PubChem CID 3316791) has the molecular formula C20H21Br2N3O4S2 and a molecular weight of 591.35 g/mol. Its IUPAC name is 2-(2,4-dibromophenoxy)-N-[(4-piperidin-1-ylsulfonylphenyl)carbamothioyl]acetamide.
| Compound Name | 2-(2,4-dibromophenoxy)-N-[(4-piperidin-1-ylsulfonylphenyl)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 3316791 |
| Molecular Formula | C20H21Br2N3O4S2 |
| Molecular Weight | 591.35 g/mol |
| Exact Mass | 588.93 |
| IUPAC Name | 2-(2,4-dibromophenoxy)-N-[(4-piperidin-1-ylsulfonylphenyl)carbamothioyl]acetamide |
| SMILES | O=C(COc1ccc(Br)cc1Br)NC(=S)Nc1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H21Br2N3O4S2/c21-14-4-9-18(17(22)12-14)29-13-19(26)24-20(30)23-15-5-7-16(8-6-15)31(27,28)25-10-2-1-3-11-25/h4-9,12H,1-3,10-11,13H2,(H2,23,24,26,30) |
| InChIKey | GMUAYZOJLAVEPF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.35 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|