C22H27N3O4S2 — CID 4634964
N-[[4-(azepan-1-ylsulfonyl)phenyl]carbamothioyl]-2-(3-methylphenoxy)acetamide (PubChem CID 4634964) has the molecular formula C22H27N3O4S2 and a molecular weight of 461.61 g/mol. Its IUPAC name is N-[[4-(azepan-1-ylsulfonyl)phenyl]carbamothioyl]-2-(3-methylphenoxy)acetamide.
| Compound Name | N-[[4-(azepan-1-ylsulfonyl)phenyl]carbamothioyl]-2-(3-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 4634964 |
| Molecular Formula | C22H27N3O4S2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | N-[[4-(azepan-1-ylsulfonyl)phenyl]carbamothioyl]-2-(3-methylphenoxy)acetamide |
| SMILES | Cc1cccc(OCC(=O)NC(=S)Nc2ccc(S(=O)(=O)N3CCCCCC3)cc2)c1 |
| InChI | InChI=1S/C22H27N3O4S2/c1-17-7-6-8-19(15-17)29-16-21(26)24-22(30)23-18-9-11-20(12-10-18)31(27,28)25-13-4-2-3-5-14-25/h6-12,15H,2-5,13-14,16H2,1H3,(H2,23,24,26,30) |
| InChIKey | FCANDNXSDLPJIS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|