C18H17BrN2O4 — CID 2625552
[2-[(2,4-dimethylphenyl)carbamoylamino]-2-oxoethyl] 4-bromobenzoate (PubChem CID 2625552) has the molecular formula C18H17BrN2O4 and a molecular weight of 405.25 g/mol. Its IUPAC name is [2-[(2,4-dimethylphenyl)carbamoylamino]-2-oxoethyl] 4-bromobenzoate.
| Compound Name | [2-[(2,4-dimethylphenyl)carbamoylamino]-2-oxoethyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 2625552 |
| Molecular Formula | C18H17BrN2O4 |
| Molecular Weight | 405.25 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | [2-[(2,4-dimethylphenyl)carbamoylamino]-2-oxoethyl] 4-bromobenzoate |
| SMILES | Cc1ccc(NC(=O)NC(=O)COC(=O)c2ccc(Br)cc2)c(C)c1 |
| InChI | InChI=1S/C18H17BrN2O4/c1-11-3-8-15(12(2)9-11)20-18(24)21-16(22)10-25-17(23)13-4-6-14(19)7-5-13/h3-9H,10H2,1-2H3,(H2,20,21,22,24) |
| InChIKey | XHCQEWJCZJPEQJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.25 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |