C23H19Br2NO4 — CID 19179693
[4-[(2,4-dimethylphenyl)carbamoyl]phenyl] 2-(2,4-dibromophenoxy)acetate (PubChem CID 19179693) has the molecular formula C23H19Br2NO4 and a molecular weight of 533.22 g/mol. Its IUPAC name is [4-[(2,4-dimethylphenyl)carbamoyl]phenyl] 2-(2,4-dibromophenoxy)acetate.
| Compound Name | [4-[(2,4-dimethylphenyl)carbamoyl]phenyl] 2-(2,4-dibromophenoxy)acetate |
|---|---|
| PubChem CID | 19179693 |
| Molecular Formula | C23H19Br2NO4 |
| Molecular Weight | 533.22 g/mol |
| Exact Mass | 530.97 |
| IUPAC Name | [4-[(2,4-dimethylphenyl)carbamoyl]phenyl] 2-(2,4-dibromophenoxy)acetate |
| SMILES | Cc1ccc(NC(=O)c2ccc(OC(=O)COc3ccc(Br)cc3Br)cc2)c(C)c1 |
| InChI | InChI=1S/C23H19Br2NO4/c1-14-3-9-20(15(2)11-14)26-23(28)16-4-7-18(8-5-16)30-22(27)13-29-21-10-6-17(24)12-19(21)25/h3-12H,13H2,1-2H3,(H,26,28) |
| InChIKey | OQAJVLGFIRZKQN-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.22 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|