C28H31NO6 — CID 19181567
[4-[(2,4-dimethylphenyl)carbamoyl]phenyl] 3,4,5-triethoxybenzoate (PubChem CID 19181567) has the molecular formula C28H31NO6 and a molecular weight of 477.56 g/mol. Its IUPAC name is [4-[(2,4-dimethylphenyl)carbamoyl]phenyl] 3,4,5-triethoxybenzoate.
| Compound Name | [4-[(2,4-dimethylphenyl)carbamoyl]phenyl] 3,4,5-triethoxybenzoate |
|---|---|
| PubChem CID | 19181567 |
| Molecular Formula | C28H31NO6 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | [4-[(2,4-dimethylphenyl)carbamoyl]phenyl] 3,4,5-triethoxybenzoate |
| SMILES | CCOc1cc(C(=O)Oc2ccc(C(=O)Nc3ccc(C)cc3C)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C28H31NO6/c1-6-32-24-16-21(17-25(33-7-2)26(24)34-8-3)28(31)35-22-12-10-20(11-13-22)27(30)29-23-14-9-18(4)15-19(23)5/h9-17H,6-8H2,1-5H3,(H,29,30) |
| InChIKey | KUITXOZBSZEDCW-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|