C25H25NO5 — CID 19180385
[4-[(2,5-dimethylphenyl)carbamoyl]phenyl] 2-(4-ethoxyphenoxy)acetate (PubChem CID 19180385) has the molecular formula C25H25NO5 and a molecular weight of 419.48 g/mol. Its IUPAC name is [4-[(2,5-dimethylphenyl)carbamoyl]phenyl] 2-(4-ethoxyphenoxy)acetate.
| Compound Name | [4-[(2,5-dimethylphenyl)carbamoyl]phenyl] 2-(4-ethoxyphenoxy)acetate |
|---|---|
| PubChem CID | 19180385 |
| Molecular Formula | C25H25NO5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | [4-[(2,5-dimethylphenyl)carbamoyl]phenyl] 2-(4-ethoxyphenoxy)acetate |
| SMILES | CCOc1ccc(OCC(=O)Oc2ccc(C(=O)Nc3cc(C)ccc3C)cc2)cc1 |
| InChI | InChI=1S/C25H25NO5/c1-4-29-20-11-13-21(14-12-20)30-16-24(27)31-22-9-7-19(8-10-22)25(28)26-23-15-17(2)5-6-18(23)3/h5-15H,4,16H2,1-3H3,(H,26,28) |
| InChIKey | IDPYCTZWTKOLPZ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|