4-[4-[(2,5-dimethylphenyl)carbamoyl]phenoxy]butanoic acid

C19H21NO4 — CID 22687067

IUPAC4-[4-[(2,5-dimethylphenyl)carbamoyl]phenoxy]butanoic acid
SMILESCc1ccc(C)c(NC(=O)c2ccc(OCCCC(=O)O)cc2)c1
InChIInChI=1S/C19H21NO4/c1-13-5-6-14(2)17(12-13)20-19(23)15-7-9-16(10-8-15)24-11-3-4-18(21)22/h5-10,12H,3-4,11H2,1-2H3,(H,20,23)(H,21,22)
InChIKeyOJKOJNFXQJWFGP-UHFFFAOYSA-N
MW327.38 g/mol
LogP3.80
Rot. Bonds7

About 4-[4-[(2,5-dimethylphenyl)carbamoyl]phenoxy]butanoic acid

4-[4-[(2,5-dimethylphenyl)carbamoyl]phenoxy]butanoic acid (PubChem CID 22687067) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is 4-[4-[(2,5-dimethylphenyl)carbamoyl]phenoxy]butanoic acid.

Molecular Properties

Compound Name4-[4-[(2,5-dimethylphenyl)carbamoyl]phenoxy]butanoic acid
PubChem CID22687067
Molecular FormulaC19H21NO4
Molecular Weight327.38 g/mol
Exact Mass327.15
IUPAC Name4-[4-[(2,5-dimethylphenyl)carbamoyl]phenoxy]butanoic acid
SMILESCc1ccc(C)c(NC(=O)c2ccc(OCCCC(=O)O)cc2)c1
InChIInChI=1S/C19H21NO4/c1-13-5-6-14(2)17(12-13)20-19(23)15-7-9-16(10-8-15)24-11-3-4-18(21)22/h5-10,12H,3-4,11H2,1-2H3,(H,20,23)(H,21,22)
InChIKeyOJKOJNFXQJWFGP-UHFFFAOYSA-N
XLogP3.80
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500327.38
LogP ≤ 53.80
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-[4-[(2,5-dimethylphenyl)carbamoyl]phenoxy]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[4-[(2,5-dimethylphenyl)carbamoyl]phenoxy]butanoic acid?
The IUPAC name of 4-[4-[(2,5-dimethylphenyl)carbamoyl]phenoxy]butanoic acid (CID 22687067) is 4-[4-[(2,5-dimethylphenyl)carbamoyl]phenoxy]butanoic acid.
What is the SMILES notation for 4-[4-[(2,5-dimethylphenyl)carbamoyl]phenoxy]butanoic acid?
The canonical SMILES for 4-[4-[(2,5-dimethylphenyl)carbamoyl]phenoxy]butanoic acid is Cc1ccc(C)c(NC(=O)c2ccc(OCCCC(=O)O)cc2)c1.
What is the InChIKey of 4-[4-[(2,5-dimethylphenyl)carbamoyl]phenoxy]butanoic acid?
The InChIKey is OJKOJNFXQJWFGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO4/c1-13-5-6-14(2)17(12-13)20-19(23)15-7-9-16(10-8-15)24-11-3-4-18(21)22/h5-10,12H,3-4,11H2,1-2H3,(H,20,23)(H,21,22).
What are the key properties of 4-[4-[(2,5-dimethylphenyl)carbamoyl]phenoxy]butanoic acid?
4-[4-[(2,5-dimethylphenyl)carbamoyl]phenoxy]butanoic acid has a molecular weight of 327.38 g/mol, XLogP of 3.80, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(2,5-dimethylphenyl)carbamoyl]phenoxy]butanoic acid is sourced from PubChem (CID 22687067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).