C24H25NO3 — CID 7709509
4-[3-(3-methylphenoxy)propoxy]-N-(2-methylphenyl)benzamide (PubChem CID 7709509) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is 4-[3-(3-methylphenoxy)propoxy]-N-(2-methylphenyl)benzamide.
| Compound Name | 4-[3-(3-methylphenoxy)propoxy]-N-(2-methylphenyl)benzamide |
|---|---|
| PubChem CID | 7709509 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 4-[3-(3-methylphenoxy)propoxy]-N-(2-methylphenyl)benzamide |
| SMILES | Cc1cccc(OCCCOc2ccc(C(=O)Nc3ccccc3C)cc2)c1 |
| InChI | InChI=1S/C24H25NO3/c1-18-7-5-9-22(17-18)28-16-6-15-27-21-13-11-20(12-14-21)24(26)25-23-10-4-3-8-19(23)2/h3-5,7-14,17H,6,15-16H2,1-2H3,(H,25,26) |
| InChIKey | HDXXIQVUPVUECY-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|