C23H23NO3 — CID 4954927
N-(2,5-dimethylphenyl)-3-(2-phenoxyethoxy)benzamide (PubChem CID 4954927) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-3-(2-phenoxyethoxy)benzamide.
| Compound Name | N-(2,5-dimethylphenyl)-3-(2-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 4954927 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | N-(2,5-dimethylphenyl)-3-(2-phenoxyethoxy)benzamide |
| SMILES | Cc1ccc(C)c(NC(=O)c2cccc(OCCOc3ccccc3)c2)c1 |
| InChI | InChI=1S/C23H23NO3/c1-17-11-12-18(2)22(15-17)24-23(25)19-7-6-10-21(16-19)27-14-13-26-20-8-4-3-5-9-20/h3-12,15-16H,13-14H2,1-2H3,(H,24,25) |
| InChIKey | MFFPWHULQGOANJ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|