C22H18BrNO3 — CID 19184755
[4-[(2,5-dimethylphenyl)carbamoyl]phenyl] 4-bromobenzoate (PubChem CID 19184755) has the molecular formula C22H18BrNO3 and a molecular weight of 424.29 g/mol. Its IUPAC name is [4-[(2,5-dimethylphenyl)carbamoyl]phenyl] 4-bromobenzoate.
| Compound Name | [4-[(2,5-dimethylphenyl)carbamoyl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 19184755 |
| Molecular Formula | C22H18BrNO3 |
| Molecular Weight | 424.29 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | [4-[(2,5-dimethylphenyl)carbamoyl]phenyl] 4-bromobenzoate |
| SMILES | Cc1ccc(C)c(NC(=O)c2ccc(OC(=O)c3ccc(Br)cc3)cc2)c1 |
| InChI | InChI=1S/C22H18BrNO3/c1-14-3-4-15(2)20(13-14)24-21(25)16-7-11-19(12-8-16)27-22(26)17-5-9-18(23)10-6-17/h3-13H,1-2H3,(H,24,25) |
| InChIKey | RHFBNSZEPLYLTF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.29 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|