C27H29NO4 — CID 19180225
[4-[(2,5-dimethylphenyl)carbamoyl]phenyl] 2-(3-methyl-4-propan-2-ylphenoxy)acetate (PubChem CID 19180225) has the molecular formula C27H29NO4 and a molecular weight of 431.53 g/mol. Its IUPAC name is [4-[(2,5-dimethylphenyl)carbamoyl]phenyl] 2-(3-methyl-4-propan-2-ylphenoxy)acetate.
| Compound Name | [4-[(2,5-dimethylphenyl)carbamoyl]phenyl] 2-(3-methyl-4-propan-2-ylphenoxy)acetate |
|---|---|
| PubChem CID | 19180225 |
| Molecular Formula | C27H29NO4 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | [4-[(2,5-dimethylphenyl)carbamoyl]phenyl] 2-(3-methyl-4-propan-2-ylphenoxy)acetate |
| SMILES | Cc1ccc(C)c(NC(=O)c2ccc(OC(=O)COc3ccc(C(C)C)c(C)c3)cc2)c1 |
| InChI | InChI=1S/C27H29NO4/c1-17(2)24-13-12-23(15-20(24)5)31-16-26(29)32-22-10-8-21(9-11-22)27(30)28-25-14-18(3)6-7-19(25)4/h6-15,17H,16H2,1-5H3,(H,28,30) |
| InChIKey | FLRUVLONVFJNHI-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|