C20H24FNO4 — CID 26663505
3,4,5-triethoxy-N-(2-fluoro-4-methylphenyl)benzamide (PubChem CID 26663505) has the molecular formula C20H24FNO4 and a molecular weight of 361.41 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-(2-fluoro-4-methylphenyl)benzamide.
| Compound Name | 3,4,5-triethoxy-N-(2-fluoro-4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 26663505 |
| Molecular Formula | C20H24FNO4 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 3,4,5-triethoxy-N-(2-fluoro-4-methylphenyl)benzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(C)cc2F)cc(OCC)c1OCC |
| InChI | InChI=1S/C20H24FNO4/c1-5-24-17-11-14(12-18(25-6-2)19(17)26-7-3)20(23)22-16-9-8-13(4)10-15(16)21/h8-12H,5-7H2,1-4H3,(H,22,23) |
| InChIKey | ZYXHGRUSWLBZMO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |