C20H27ClN2O4 — CID 120569013
N-(5-amino-2-methylphenyl)-3,4,5-triethoxybenzamide;hydrochloride (PubChem CID 120569013) has the molecular formula C20H27ClN2O4 and a molecular weight of 394.90 g/mol. Its IUPAC name is N-(5-amino-2-methylphenyl)-3,4,5-triethoxybenzamide;hydrochloride.
| Compound Name | N-(5-amino-2-methylphenyl)-3,4,5-triethoxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 120569013 |
| Molecular Formula | C20H27ClN2O4 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | N-(5-amino-2-methylphenyl)-3,4,5-triethoxybenzamide;hydrochloride |
| SMILES | CCOc1cc(C(=O)Nc2cc(N)ccc2C)cc(OCC)c1OCC.Cl |
| InChI | InChI=1S/C20H26N2O4.ClH/c1-5-24-17-10-14(11-18(25-6-2)19(17)26-7-3)20(23)22-16-12-15(21)9-8-13(16)4;/h8-12H,5-7,21H2,1-4H3,(H,22,23);1H |
| InChIKey | IKJBTNNVOKPXFL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|