C19H23FN2O4 — CID 16778120
N-(5-amino-2-fluorophenyl)-3,4,5-triethoxybenzamide (PubChem CID 16778120) has the molecular formula C19H23FN2O4 and a molecular weight of 362.40 g/mol. Its IUPAC name is N-(5-amino-2-fluorophenyl)-3,4,5-triethoxybenzamide.
| Compound Name | N-(5-amino-2-fluorophenyl)-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 16778120 |
| Molecular Formula | C19H23FN2O4 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N-(5-amino-2-fluorophenyl)-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)Nc2cc(N)ccc2F)cc(OCC)c1OCC |
| InChI | InChI=1S/C19H23FN2O4/c1-4-24-16-9-12(10-17(25-5-2)18(16)26-6-3)19(23)22-15-11-13(21)7-8-14(15)20/h7-11H,4-6,21H2,1-3H3,(H,22,23) |
| InChIKey | IVBBGXBGUHIUMC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|