C20H22ClFN2O5 — CID 26586710
N'-(5-chloro-2-fluorobenzoyl)-3,4,5-triethoxybenzohydrazide (PubChem CID 26586710) has the molecular formula C20H22ClFN2O5 and a molecular weight of 424.86 g/mol. Its IUPAC name is N'-(5-chloro-2-fluorobenzoyl)-3,4,5-triethoxybenzohydrazide.
| Compound Name | N'-(5-chloro-2-fluorobenzoyl)-3,4,5-triethoxybenzohydrazide |
|---|---|
| PubChem CID | 26586710 |
| Molecular Formula | C20H22ClFN2O5 |
| Molecular Weight | 424.86 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | N'-(5-chloro-2-fluorobenzoyl)-3,4,5-triethoxybenzohydrazide |
| SMILES | CCOc1cc(C(=O)NNC(=O)c2cc(Cl)ccc2F)cc(OCC)c1OCC |
| InChI | InChI=1S/C20H22ClFN2O5/c1-4-27-16-9-12(10-17(28-5-2)18(16)29-6-3)19(25)23-24-20(26)14-11-13(21)7-8-15(14)22/h7-11H,4-6H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | XTLLXIYOHYYHQP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.86 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|