C22H26Cl2N2O5 — CID 46569178
N'-[3-(2,4-dichlorophenyl)propanoyl]-3,4,5-triethoxybenzohydrazide (PubChem CID 46569178) has the molecular formula C22H26Cl2N2O5 and a molecular weight of 469.37 g/mol. Its IUPAC name is N'-[3-(2,4-dichlorophenyl)propanoyl]-3,4,5-triethoxybenzohydrazide.
| Compound Name | N'-[3-(2,4-dichlorophenyl)propanoyl]-3,4,5-triethoxybenzohydrazide |
|---|---|
| PubChem CID | 46569178 |
| Molecular Formula | C22H26Cl2N2O5 |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | N'-[3-(2,4-dichlorophenyl)propanoyl]-3,4,5-triethoxybenzohydrazide |
| SMILES | CCOc1cc(C(=O)NNC(=O)CCc2ccc(Cl)cc2Cl)cc(OCC)c1OCC |
| InChI | InChI=1S/C22H26Cl2N2O5/c1-4-29-18-11-15(12-19(30-5-2)21(18)31-6-3)22(28)26-25-20(27)10-8-14-7-9-16(23)13-17(14)24/h7,9,11-13H,4-6,8,10H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | XLEGRTXNOXCBTI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|