C25H29N3O5 — CID 46422379
3,4,5-triethoxy-N'-[2-(4-pyrrol-1-ylphenyl)acetyl]benzohydrazide (PubChem CID 46422379) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is 3,4,5-triethoxy-N'-[2-(4-pyrrol-1-ylphenyl)acetyl]benzohydrazide.
| Compound Name | 3,4,5-triethoxy-N'-[2-(4-pyrrol-1-ylphenyl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 46422379 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 3,4,5-triethoxy-N'-[2-(4-pyrrol-1-ylphenyl)acetyl]benzohydrazide |
| SMILES | CCOc1cc(C(=O)NNC(=O)Cc2ccc(-n3cccc3)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C25H29N3O5/c1-4-31-21-16-19(17-22(32-5-2)24(21)33-6-3)25(30)27-26-23(29)15-18-9-11-20(12-10-18)28-13-7-8-14-28/h7-14,16-17H,4-6,15H2,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | KIBRDCCWWFKZLO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|