C22H27N3O6 — CID 26798129
N-[4-[[(3,4,5-triethoxybenzoyl)amino]carbamoyl]phenyl]acetamide (PubChem CID 26798129) has the molecular formula C22H27N3O6 and a molecular weight of 429.47 g/mol. Its IUPAC name is N-[4-[[(3,4,5-triethoxybenzoyl)amino]carbamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[(3,4,5-triethoxybenzoyl)amino]carbamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 26798129 |
| Molecular Formula | C22H27N3O6 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | N-[4-[[(3,4,5-triethoxybenzoyl)amino]carbamoyl]phenyl]acetamide |
| SMILES | CCOc1cc(C(=O)NNC(=O)c2ccc(NC(C)=O)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C22H27N3O6/c1-5-29-18-12-16(13-19(30-6-2)20(18)31-7-3)22(28)25-24-21(27)15-8-10-17(11-9-15)23-14(4)26/h8-13H,5-7H2,1-4H3,(H,23,26)(H,24,27)(H,25,28) |
| InChIKey | WRBSYNXOFMIOTC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|