C20H23Cl2NO2 — CID 100606977
3-(2,4-dichlorophenyl)-N-[3-(2-ethoxyphenyl)propyl]propanamide (PubChem CID 100606977) has the molecular formula C20H23Cl2NO2 and a molecular weight of 380.32 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N-[3-(2-ethoxyphenyl)propyl]propanamide.
| Compound Name | 3-(2,4-dichlorophenyl)-N-[3-(2-ethoxyphenyl)propyl]propanamide |
|---|---|
| PubChem CID | 100606977 |
| Molecular Formula | C20H23Cl2NO2 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N-[3-(2-ethoxyphenyl)propyl]propanamide |
| SMILES | CCOc1ccccc1CCCNC(=O)CCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H23Cl2NO2/c1-2-25-19-8-4-3-6-16(19)7-5-13-23-20(24)12-10-15-9-11-17(21)14-18(15)22/h3-4,6,8-9,11,14H,2,5,7,10,12-13H2,1H3,(H,23,24) |
| InChIKey | JBLNPFJQTJSKFQ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|