C18H20Cl2N2O — CID 120611624
3-(2-aminophenyl)-N-[3-(2,4-dichlorophenyl)propyl]propanamide (PubChem CID 120611624) has the molecular formula C18H20Cl2N2O and a molecular weight of 351.28 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[3-(2,4-dichlorophenyl)propyl]propanamide.
| Compound Name | 3-(2-aminophenyl)-N-[3-(2,4-dichlorophenyl)propyl]propanamide |
|---|---|
| PubChem CID | 120611624 |
| Molecular Formula | C18H20Cl2N2O |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 3-(2-aminophenyl)-N-[3-(2,4-dichlorophenyl)propyl]propanamide |
| SMILES | Nc1ccccc1CCC(=O)NCCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H20Cl2N2O/c19-15-9-7-13(16(20)12-15)5-3-11-22-18(23)10-8-14-4-1-2-6-17(14)21/h1-2,4,6-7,9,12H,3,5,8,10-11,21H2,(H,22,23) |
| InChIKey | MOCVJMYZGCARPQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|