C20H26N2O — CID 120610401
3-(2-aminophenyl)-N-(5-phenylpentyl)propanamide (PubChem CID 120610401) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-(5-phenylpentyl)propanamide.
| Compound Name | 3-(2-aminophenyl)-N-(5-phenylpentyl)propanamide |
|---|---|
| PubChem CID | 120610401 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 3-(2-aminophenyl)-N-(5-phenylpentyl)propanamide |
| SMILES | Nc1ccccc1CCC(=O)NCCCCCc1ccccc1 |
| InChI | InChI=1S/C20H26N2O/c21-19-13-7-6-12-18(19)14-15-20(23)22-16-8-2-5-11-17-9-3-1-4-10-17/h1,3-4,6-7,9-10,12-13H,2,5,8,11,14-16,21H2,(H,22,23) |
| InChIKey | YBNHAQVDVIISSB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|