C24H35Cl2N3O2 — CID 120613441
3-(2-aminophenyl)-N-[3-(1-benzylpiperidin-4-yl)oxypropyl]propanamide;dihydrochloride (PubChem CID 120613441) has the molecular formula C24H35Cl2N3O2 and a molecular weight of 468.47 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[3-(1-benzylpiperidin-4-yl)oxypropyl]propanamide;dihydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-[3-(1-benzylpiperidin-4-yl)oxypropyl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 120613441 |
| Molecular Formula | C24H35Cl2N3O2 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 3-(2-aminophenyl)-N-[3-(1-benzylpiperidin-4-yl)oxypropyl]propanamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccccc1CCC(=O)NCCCOC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H33N3O2.2ClH/c25-23-10-5-4-9-21(23)11-12-24(28)26-15-6-18-29-22-13-16-27(17-14-22)19-20-7-2-1-3-8-20;;/h1-5,7-10,22H,6,11-19,25H2,(H,26,28);2*1H |
| InChIKey | HQMHCBUSXXNNEE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|