C18H32Cl2N4O — CID 120613391
3-(2-aminophenyl)-N-[2-[4-(dimethylamino)piperidin-1-yl]ethyl]propanamide;dihydrochloride (PubChem CID 120613391) has the molecular formula C18H32Cl2N4O and a molecular weight of 391.39 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[2-[4-(dimethylamino)piperidin-1-yl]ethyl]propanamide;dihydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-[2-[4-(dimethylamino)piperidin-1-yl]ethyl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 120613391 |
| Molecular Formula | C18H32Cl2N4O |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 3-(2-aminophenyl)-N-[2-[4-(dimethylamino)piperidin-1-yl]ethyl]propanamide;dihydrochloride |
| SMILES | CN(C)C1CCN(CCNC(=O)CCc2ccccc2N)CC1.Cl.Cl |
| InChI | InChI=1S/C18H30N4O.2ClH/c1-21(2)16-9-12-22(13-10-16)14-11-20-18(23)8-7-15-5-3-4-6-17(15)19;;/h3-6,16H,7-14,19H2,1-2H3,(H,20,23);2*1H |
| InChIKey | VPUGONCTSYGNNF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|