C23H33Cl2N3O2 — CID 119897800
2-amino-N-[3-(1-benzylpiperidin-4-yl)oxypropyl]-2-phenylacetamide;dihydrochloride (PubChem CID 119897800) has the molecular formula C23H33Cl2N3O2 and a molecular weight of 454.44 g/mol. Its IUPAC name is 2-amino-N-[3-(1-benzylpiperidin-4-yl)oxypropyl]-2-phenylacetamide;dihydrochloride.
| Compound Name | 2-amino-N-[3-(1-benzylpiperidin-4-yl)oxypropyl]-2-phenylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 119897800 |
| Molecular Formula | C23H33Cl2N3O2 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 2-amino-N-[3-(1-benzylpiperidin-4-yl)oxypropyl]-2-phenylacetamide;dihydrochloride |
| SMILES | Cl.Cl.NC(C(=O)NCCCOC1CCN(Cc2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C23H31N3O2.2ClH/c24-22(20-10-5-2-6-11-20)23(27)25-14-7-17-28-21-12-15-26(16-13-21)18-19-8-3-1-4-9-19;;/h1-6,8-11,21-22H,7,12-18,24H2,(H,25,27);2*1H |
| InChIKey | BILYLPAHVGCQOL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|