C22H35N3O2 — CID 55473586
4-benzyl-N-(3-cyclohexyloxypropyl)-1,4-diazepane-1-carboxamide (PubChem CID 55473586) has the molecular formula C22H35N3O2 and a molecular weight of 373.54 g/mol. Its IUPAC name is 4-benzyl-N-(3-cyclohexyloxypropyl)-1,4-diazepane-1-carboxamide.
| Compound Name | 4-benzyl-N-(3-cyclohexyloxypropyl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 55473586 |
| Molecular Formula | C22H35N3O2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.27 |
| IUPAC Name | 4-benzyl-N-(3-cyclohexyloxypropyl)-1,4-diazepane-1-carboxamide |
| SMILES | O=C(NCCCOC1CCCCC1)N1CCCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H35N3O2/c26-22(23-13-7-18-27-21-11-5-2-6-12-21)25-15-8-14-24(16-17-25)19-20-9-3-1-4-10-20/h1,3-4,9-10,21H,2,5-8,11-19H2,(H,23,26) |
| InChIKey | MELLNSCXMHNINO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|