C20H29N3O2 — CID 46429504
N-[4-(4-benzyl-1,4-diazepan-1-yl)-4-oxobutyl]cyclopropanecarboxamide (PubChem CID 46429504) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is N-[4-(4-benzyl-1,4-diazepan-1-yl)-4-oxobutyl]cyclopropanecarboxamide.
| Compound Name | N-[4-(4-benzyl-1,4-diazepan-1-yl)-4-oxobutyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 46429504 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | N-[4-(4-benzyl-1,4-diazepan-1-yl)-4-oxobutyl]cyclopropanecarboxamide |
| SMILES | O=C(NCCCC(=O)N1CCCN(Cc2ccccc2)CC1)C1CC1 |
| InChI | InChI=1S/C20H29N3O2/c24-19(8-4-11-21-20(25)18-9-10-18)23-13-5-12-22(14-15-23)16-17-6-2-1-3-7-17/h1-3,6-7,18H,4-5,8-16H2,(H,21,25) |
| InChIKey | ZHLABDXVRJGTSI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|