C20H25N3O3 — CID 43044219
N-[3-(4-benzyl-1,4-diazepan-1-yl)-3-oxopropyl]furan-2-carboxamide (PubChem CID 43044219) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-[3-(4-benzyl-1,4-diazepan-1-yl)-3-oxopropyl]furan-2-carboxamide.
| Compound Name | N-[3-(4-benzyl-1,4-diazepan-1-yl)-3-oxopropyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 43044219 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-[3-(4-benzyl-1,4-diazepan-1-yl)-3-oxopropyl]furan-2-carboxamide |
| SMILES | O=C(NCCC(=O)N1CCCN(Cc2ccccc2)CC1)c1ccco1 |
| InChI | InChI=1S/C20H25N3O3/c24-19(9-10-21-20(25)18-8-4-15-26-18)23-12-5-11-22(13-14-23)16-17-6-2-1-3-7-17/h1-4,6-8,15H,5,9-14,16H2,(H,21,25) |
| InChIKey | BDEJTDQYRSDCCZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |