C20H35Cl2N3O2 — CID 120565898
4-amino-N-[3-(1-benzylpiperidin-4-yl)oxypropyl]pentanamide;dihydrochloride (PubChem CID 120565898) has the molecular formula C20H35Cl2N3O2 and a molecular weight of 420.43 g/mol. Its IUPAC name is 4-amino-N-[3-(1-benzylpiperidin-4-yl)oxypropyl]pentanamide;dihydrochloride.
| Compound Name | 4-amino-N-[3-(1-benzylpiperidin-4-yl)oxypropyl]pentanamide;dihydrochloride |
|---|---|
| PubChem CID | 120565898 |
| Molecular Formula | C20H35Cl2N3O2 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 4-amino-N-[3-(1-benzylpiperidin-4-yl)oxypropyl]pentanamide;dihydrochloride |
| SMILES | CC(N)CCC(=O)NCCCOC1CCN(Cc2ccccc2)CC1.Cl.Cl |
| InChI | InChI=1S/C20H33N3O2.2ClH/c1-17(21)8-9-20(24)22-12-5-15-25-19-10-13-23(14-11-19)16-18-6-3-2-4-7-18;;/h2-4,6-7,17,19H,5,8-16,21H2,1H3,(H,22,24);2*1H |
| InChIKey | FUMZSHLZDRQNHO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|