C21H32FN3O4S — CID 55794163
N-(3-cyclohexyloxypropyl)-4-(4-fluorophenyl)sulfonyl-1,4-diazepane-1-carboxamide (PubChem CID 55794163) has the molecular formula C21H32FN3O4S and a molecular weight of 441.57 g/mol. Its IUPAC name is N-(3-cyclohexyloxypropyl)-4-(4-fluorophenyl)sulfonyl-1,4-diazepane-1-carboxamide.
| Compound Name | N-(3-cyclohexyloxypropyl)-4-(4-fluorophenyl)sulfonyl-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 55794163 |
| Molecular Formula | C21H32FN3O4S |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | N-(3-cyclohexyloxypropyl)-4-(4-fluorophenyl)sulfonyl-1,4-diazepane-1-carboxamide |
| SMILES | O=C(NCCCOC1CCCCC1)N1CCCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H32FN3O4S/c22-18-8-10-20(11-9-18)30(27,28)25-14-5-13-24(15-16-25)21(26)23-12-4-17-29-19-6-2-1-3-7-19/h8-11,19H,1-7,12-17H2,(H,23,26) |
| InChIKey | VMXSRRVRSAHZHI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|