C20H30N4O4 — CID 41356313
N-(3-cyclohexyloxypropyl)-4-(4-nitrophenyl)piperazine-1-carboxamide (PubChem CID 41356313) has the molecular formula C20H30N4O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is N-(3-cyclohexyloxypropyl)-4-(4-nitrophenyl)piperazine-1-carboxamide.
| Compound Name | N-(3-cyclohexyloxypropyl)-4-(4-nitrophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 41356313 |
| Molecular Formula | C20H30N4O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | N-(3-cyclohexyloxypropyl)-4-(4-nitrophenyl)piperazine-1-carboxamide |
| SMILES | O=C(NCCCOC1CCCCC1)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C20H30N4O4/c25-20(21-11-4-16-28-19-5-2-1-3-6-19)23-14-12-22(13-15-23)17-7-9-18(10-8-17)24(26)27/h7-10,19H,1-6,11-16H2,(H,21,25) |
| InChIKey | NPZWCFGVIATJFA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|